
CAS 870703-49-4
:2,5-Dibromo-4-(decyloxy)phenol
Description:
2,5-Dibromo-4-(decyloxy)phenol is an organic compound characterized by its phenolic structure, which includes two bromine substituents at the 2 and 5 positions and a decyloxy group at the 4 position. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the nature of the decyloxy chain. The presence of bromine atoms contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The decyloxy group enhances its hydrophobic characteristics, making it useful in formulations where solubility in non-polar solvents is desired. Additionally, the compound may exhibit biological activity, which could be of interest in fields such as medicinal chemistry or materials science. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 2,5-Dibromo-4-(decyloxy)phenol is a versatile compound with potential applications in various chemical and industrial processes.
Formula:C16H24Br2O2
InChI:InChI=1S/C16H24Br2O2/c1-2-3-4-5-6-7-8-9-10-20-16-12-13(17)15(19)11-14(16)18/h11-12,19H,2-10H2,1H3
InChI key:InChIKey=SSEJKDGLNTZULX-UHFFFAOYSA-N
SMILES:O(CCCCCCCCCC)C1=C(Br)C=C(O)C(Br)=C1
Synonyms:- 2,5-Dibromo-4-(decyloxy)phenol
- Phenol, 2,5-dibromo-4-(decyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.