CAS 870703-52-9
:9H-carbazol-2-yl trifluoromethanesulfonate
Description:
9H-Carbazol-2-yl trifluoromethanesulfonate, with the CAS number 870703-52-9, is an organic compound characterized by the presence of a carbazole moiety and a trifluoromethanesulfonate functional group. The carbazole structure contributes to its aromatic properties, making it a potential candidate for applications in organic electronics and photonics due to its ability to facilitate charge transport. The trifluoromethanesulfonate group, known for its strong electrophilic nature, enhances the reactivity of the compound, making it useful in various chemical transformations, including nucleophilic substitutions. This compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its unique combination of structural features allows it to participate in diverse chemical reactions, making it valuable in synthetic organic chemistry. Safety data should be consulted for handling, as the trifluoromethanesulfonate group can pose hazards typical of sulfonate esters. Overall, 9H-carbazol-2-yl trifluoromethanesulfonate is a versatile compound with potential applications in advanced materials and chemical synthesis.
Formula:C13H8F3NO3S
InChI:InChI=1/C13H8F3NO3S/c14-13(15,16)21(18,19)20-8-5-6-10-9-3-1-2-4-11(9)17-12(10)7-8/h1-7,17H
InChI key:InChIKey=DTBYYTIINYTKPV-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1ccc(cc1[nH]2)OS(=O)(=O)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.