CAS 870703-56-3
:3-(1-Piperazinyl)benzaldehyde
Description:
3-(1-Piperazinyl)benzaldehyde, with the CAS number 870703-56-3, is an organic compound characterized by the presence of a benzaldehyde functional group attached to a piperazine ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The piperazine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various properties, including moderate to high melting points and specific reactivity patterns typical of aldehydes, such as undergoing oxidation or condensation reactions. Its structure allows for interactions with biological targets, which can be explored in drug design and development. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices. Overall, 3-(1-Piperazinyl)benzaldehyde serves as a valuable building block in synthetic organic chemistry and pharmaceutical research.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c14-9-10-2-1-3-11(8-10)13-6-4-12-5-7-13/h1-3,8-9,12H,4-7H2
InChI key:InChIKey=RZLIVHYKFDFVNK-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1)N2CCNCC2
Synonyms:- Benzaldehyde, 3-(1-piperazinyl)-
- 3-(1-Piperazinyl)benzaldehyde
- 1-(3-Formylphenyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
