CAS 870703-73-4

tert-butyl 4-[2-(methoxycarbonyl)-4-nitrophenyl]piperazine-1-carboxylate

Description:

Tert-butyl 4-[2-(methoxycarbonyl)-4-nitrophenyl]piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a tert-butyl group, and a nitrophenyl moiety. This compound typically exhibits properties associated with both its piperazine and aromatic components, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the nitro and carboxylate. The methoxycarbonyl group contributes to its polar character, which can influence its interactions in biological systems or chemical reactions. The presence of the nitro group may also impart specific electronic properties, making it a candidate for various applications in medicinal chemistry or as a synthetic intermediate. Overall, this compound's unique structural features suggest potential utility in drug development or as a research tool in organic synthesis. However, specific physical properties such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise characterization.

Formula: C₁₇H₂₃N₃O₆

InChI: InChI=1/C17H23N3O6/c1-17(2,3)26-16(22)19-9-7-18(8-10-19)14-6-5-12(20(23)24)11-13(14)15(21)25-4/h5-6,11H,7-10H2,1-4H3

SMILES: CC(C)(C)OC(=O)N1CCN(CC1)c1ccc(cc1C(=O)OC)N(=O)=O

tert-Butyl 4-[2-(methoxycarbonyl)-4-nitrophenyl]piperazine-1-carboxylate

CAS: 870703-73-4

tert-Butyl 4-[2-(methoxycarbonyl)-4-nitrophenyl]piperazine-1-carboxylate

Purity: ≥95%

Molecular weight: 365.38g/mol

Ref: 54-OR303931