CymitQuimica logo

CAS 870703-77-8

:

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-furanyl-1-piperidineacetic acid

Description:
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-furanyl-1-piperidineacetic acid, with the CAS number 870703-77-8, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, a furanyl group, and an amino acid moiety. This compound typically exhibits properties such as solubility in polar organic solvents and moderate stability under standard laboratory conditions. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of functional groups that can engage in hydrogen bonding and other interactions. The dimethylethoxycarbonyl group may enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the compound's unique arrangement of atoms may confer specific reactivity patterns, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the intricate design often found in bioactive molecules, combining various chemical functionalities that may contribute to its efficacy and safety profile in biological systems.
Formula:C16H24N2O5
InChI:InChI=1/C16H24N2O5/c1-16(2,3)23-15(21)17-11-6-8-18(9-7-11)13(14(19)20)12-5-4-10-22-12/h4-5,10-11,13H,6-9H2,1-3H3,(H,17,21)(H,19,20)
InChI key:InChIKey=YPMFFOGSMOXXLA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CCC(NC(OC(C)(C)C)=O)CC1)C2=CC=CO2
Synonyms:
  • 1-Piperidineacetic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-2-furanyl-
  • 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-furanyl-1-piperidineacetic acid
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.