CAS 870703-78-9

4-[(1,1-Dimethylethoxy)carbonyl]-α-ethenyl-1-piperazineacetic acid

Description:

4-[(1,1-Dimethylethoxy)carbonyl]-α-ethenyl-1-piperazineacetic acid, with the CAS number 870703-78-9, is a chemical compound characterized by its unique structure that includes a piperazine ring, an ethenyl group, and a carboxylic acid functionality. This compound typically exhibits properties associated with both amines and carboxylic acids, which can influence its solubility and reactivity. The presence of the dimethylethoxycarbonyl group suggests that it may have protective or modifying roles in synthetic pathways. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The compound may exhibit moderate to high polarity due to the functional groups present, affecting its solubility in various solvents. Additionally, the piperazine moiety can contribute to its pharmacological properties, potentially influencing its binding affinity to biological targets. Overall, this compound's characteristics make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₁₃H₂₂N₂O₄

InChI: InChI=1S/C13H22N2O4/c1-5-10(11(16)17)14-6-8-15(9-7-14)12(18)19-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,16,17)

InChI key: InChIKey=ZXJMXILXWUNTEW-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C=C)N1CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 4-[(1,1-Dimethylethoxy)carbonyl]-α-ethenyl-1-piperazineacetic acid
• 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-ethenyl-