CAS 870703-84-7
:(5-fluoro-2-sulfanyl-phenyl)methanol
Description:
(5-Fluoro-2-sulfanyl-phenyl)methanol, with the CAS number 870703-84-7, is an organic compound characterized by the presence of a phenolic structure substituted with a fluorine atom and a thiol group. The compound features a hydroxymethyl group (-CH2OH) attached to the aromatic ring, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atom enhances the compound's lipophilicity and can influence its biological activity, while the thiol group (-SH) is known for its nucleophilic properties, making it a potential candidate for various chemical reactions, including those involving disulfide bond formation or reduction. The presence of these functional groups suggests that this compound may exhibit interesting pharmacological properties, potentially serving as a lead compound in drug development. Additionally, its unique structure may allow for interactions with biological targets, making it a subject of interest in medicinal chemistry and materials science. Overall, (5-fluoro-2-sulfanyl-phenyl)methanol represents a versatile building block in synthetic organic chemistry.
Formula:C7H7FOS
InChI:InChI=1/C7H7FOS/c8-6-1-2-7(10)5(3-6)4-9/h1-3,9-10H,4H2
SMILES:c1cc(c(cc1F)CO)S
Synonyms:- [Synonyms]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
