CAS 870703-85-8
:ethyl 5-fluoro-2-sulfanylbenzoate
Description:
Ethyl 5-fluoro-2-sulfanylbenzoate is an organic compound characterized by its ester functional group and the presence of a fluorine atom and a thiol group on the aromatic ring. The molecular structure includes a benzoate moiety, where the ethyl group is attached to the carboxylate part, contributing to its ester characteristics. The presence of the fluorine atom at the 5-position of the benzene ring can influence the compound's reactivity and polarity, potentially enhancing its lipophilicity. The thiol group (sulfanyl) at the 2-position introduces nucleophilic properties, making the compound reactive in various chemical reactions, such as substitution or addition reactions. Ethyl 5-fluoro-2-sulfanylbenzoate may exhibit interesting biological activities, making it a candidate for pharmaceutical applications. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may be used in synthetic organic chemistry as an intermediate or building block for more complex molecules. Safety and handling precautions should be observed due to the potential reactivity of the thiol group.
Formula:C9H9FO2S
InChI:InChI=1/C9H9FO2S/c1-2-12-9(11)7-5-6(10)3-4-8(7)13/h3-5,13H,2H2,1H3
SMILES:CCOC(=O)c1cc(ccc1S)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
