CAS 870703-86-9

α-(Difluoromethylene)-2-pyrrolidinepropanoic acid

Description:

α-(Difluoromethylene)-2-pyrrolidinepropanoic acid, with the CAS number 870703-86-9, is a chemical compound characterized by its unique structural features, including a pyrrolidine ring and a difluoromethylene group. This compound typically exhibits properties associated with both its acidic and amine functionalities, making it a potential candidate for various applications in medicinal chemistry and drug development. The presence of the difluoromethylene group can enhance lipophilicity and metabolic stability, which are desirable traits in pharmaceutical compounds. Additionally, the pyrrolidine moiety may contribute to the compound's ability to interact with biological targets, potentially influencing its pharmacological activity. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, α-(Difluoromethylene)-2-pyrrolidinepropanoic acid represents an interesting subject for further research, particularly in the context of its synthesis, characterization, and potential therapeutic applications.

Formula: C₈H₁₁F₂NO₂

InChI: InChI=1S/C8H11F2NO2/c9-7(10)6(8(12)13)4-5-2-1-3-11-5/h5,11H,1-4H2,(H,12,13)

InChI key: InChIKey=AADSEYMFBPZLJU-UHFFFAOYSA-N

SMILES: C(CC1CCCN1)(=C(F)F)C(O)=O

Synonyms:

• 2-Pyrrolidinepropanoic acid, α-(difluoromethylene)-
• α-(Difluoromethylene)-2-pyrrolidinepropanoic acid