CymitQuimica logo

CAS 870703-89-2

:

3,3,3-trifluoro-2-{[formyl(methyl)amino]methyl}propanoic acid

Description:
3,3,3-Trifluoro-2-{[formyl(methyl)amino]methyl}propanoic acid is a synthetic organic compound characterized by its unique trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances the compound's lipophilicity and stability, making it useful in various applications, including pharmaceuticals and agrochemicals. The molecule features an amino group that is formylated, indicating the presence of a carbonyl group adjacent to the nitrogen, which can participate in various chemical reactions, such as condensation and nucleophilic attacks. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. The compound's structure suggests it may exhibit interesting biological activity, potentially serving as a building block for more complex molecules. Its CAS number, 870703-89-2, allows for easy identification in chemical databases, facilitating research and development in related fields. Overall, this compound exemplifies the interplay between functional groups and molecular structure in determining chemical behavior and potential applications.
Formula:C6H8F3NO3
InChI:InChI=1/C6H8F3NO3/c1-10(3-11)2-4(5(12)13)6(7,8)9/h3-4H,2H2,1H3,(H,12,13)
SMILES:CN(CC(C(=O)O)C(F)(F)F)C=O
Synonyms:
  • Propanoic acid, 3,3,3-trifluoro-2-[(formylmethylamino)methyl]-
  • 3-(N-ForMyl-N-MethylaMino)-2-(trifluoroMethyl)propionic acid
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.