CAS 870703-95-0
:5-(4-methoxyphenyl)isoxazole-3-carbaldehyde
Description:
5-(4-Methoxyphenyl)isoxazole-3-carbaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a methoxy group (-OCH3) attached to a phenyl ring, enhancing its solubility and reactivity. The aldehyde functional group (-CHO) at the 3-position of the isoxazole ring contributes to its reactivity, making it useful in various chemical reactions, including condensation and oxidation processes. The presence of the methoxy group can also influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its unique structure allows for various modifications, which can lead to derivatives with different biological or chemical properties. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-14-10-4-2-8(3-5-10)11-6-9(7-13)12-15-11/h2-7H,1H3
SMILES:COc1ccc(cc1)c1cc(C=O)no1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-(4-Methoxyphenyl)isoxazole-3-carboxaldehyde
CAS:<p>5-(4-Methoxyphenyl)isoxazole-3-carboxaldehyde (5MI) is a broad-spectrum antimicrobial agent that exhibits activity against bacteria and fungi. It has been shown to be active against gram-positive bacteria, including Staphylococcus aureus, as well as Candida albicans and other pathogenic fungi. 5MI is active in the presence of ethanol, but not in the absence of alcohol. In vitro studies show that 5MI inhibits the growth of gram-negative bacteria such as Escherichia coli and Salmonella enterica serovar Typhimurium. 5MI also exhibits antifungal activity against Aspergillus niger and Saccharomyces cerevisiae.</p>Formula:C11H9NO3Purity:Min. 95%Molecular weight:203.19 g/mol


