CymitQuimica logo

CAS 870703-96-1

:

5-(4-bromophenyl)isoxazole-3-carbohydrazide

Description:
5-(4-Bromophenyl)isoxazole-3-carbohydrazide is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, which can influence the compound's reactivity and biological activity. The carbohydrazide functional group suggests that the compound may exhibit properties typical of hydrazides, such as potential reactivity with various electrophiles. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to biological activity, including antimicrobial or anti-inflammatory properties. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of bromine can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions under which it is studied.
Formula:C10H8BrN3O2
InChI:InChI=1/C10H8BrN3O2/c11-7-3-1-6(2-4-7)9-5-8(14-16-9)10(15)13-12/h1-5H,12H2,(H,13,15)
SMILES:c1cc(ccc1c1cc(C(=NN)O)no1)Br
Synonyms:
  • 3-Isoxazolecarboxylic acid, 5-(4-bromophenyl)-, hydrazide
  • 5-(4-bromophenyl)-1,2-oxazole-3-carbohydrazide
  • See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.