CymitQuimica logo

CAS 870703-97-2

:

5-[4-(methylsulfanyl)phenyl]thiophene-2-carboxylic acid

Description:
5-[4-(Methylsulfanyl)phenyl]thiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of a methylsulfanyl group attached to a phenyl ring enhances its solubility and may influence its electronic properties, making it of interest in organic synthesis and materials science. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic electronics due to its conjugated system. Additionally, the specific arrangement of substituents can affect its physical properties, such as melting point and solubility, as well as its biological activity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the carboxylic acid group, which can be corrosive. Overall, this compound exemplifies the diverse chemistry associated with thiophene derivatives.
Formula:C12H10O2S2
InChI:InChI=1/C12H10O2S2/c1-15-9-4-2-8(3-5-9)10-6-7-11(16-10)12(13)14/h2-7H,1H3,(H,13,14)
SMILES:CSc1ccc(cc1)c1ccc(C(=O)O)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.