CAS 870704-22-6

3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid

Description:

3-(4-Fluorophenyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) at the 5-position contributes to its acidic properties and potential reactivity in various chemical reactions. The substitution of a fluorophenyl group at the 3-position enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically used in research settings, particularly in the development of pharmaceuticals, due to its potential as a scaffold for drug design. Its molecular structure allows for various interactions with biological targets, which can be explored for therapeutic applications. Additionally, the fluorine atom can enhance metabolic stability and alter the compound's pharmacokinetic properties. Overall, 3-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.

Formula: C₁₀H₇FN₂O₂

InChI: InChI=1/C10H7FN2O2/c11-7-3-1-6(2-4-7)8-5-9(10(14)15)13-12-8/h1-5H,(H,12,13)(H,14,15)

SMILES: c1cc(ccc1c1cc(C(=O)O)n[nH]1)F

Synonyms:

• 1H-pyrazole-3-carboxylic acid, 5-(4-fluorophenyl)-
• 1H-Pyrazole-5-carboxylic acid, 3-(4-fluorophenyl)-
• 5-(4-Fluorophenyl)-1H-pyrazole-3-carboxylic acid
• 870704-22-6
• T5Mnj Cvq Er Df
• 3-(4-Fluorophenyl)-1H-pyrazole-5-carboxylic acid
• 5-(4-FLUOROPHENYL)-1H-PYRAZOLE-3-CARBOXYLIC ACID, 95+%
• -1H-pyrazole-3-carboxylic acid

5-(4-Fluorophenyl)-1H-pyrazole-3-carboxylic acid

CAS: 870704-22-6

Formula: C₁₀H₇FN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.1732

Ref: IN-DA004GI9

3-(4-Fluorophenyl)-1H-pyrazole-5-carboxylic acid

CAS: 870704-22-6

3-(4-Fluorophenyl)-1H-pyrazole-5-carboxylic acid

Purity: 98%

Molecular weight: 206.17g/mol

Ref: 54-PC200617

3-(4-Fluoro-phenyl)-1H-pyrazole-5-carboxylic acid

CAS: 870704-22-6

Formula: C₁₀H₇FN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 206.176

Ref: 10-F028397

2-(4-Fluorophenyl)-1H-imidazole-4-carboxylic acid

CAS: 870704-22-6

2-(4-Fluorophenyl)-1H-imidazole-4-carboxylic acid (FPIC) is a thiazoloquinoline that has been shown to be a reaction product of xylene and orthogonal dehydration. FPIC is catalytic in the presence of glycols and hydroxylated thioamides, and it is an average molecule with an optimal science. It can be used for the production of ethylene glycol by irradiation.

Formula: C₁₀H₇FN₂O₂

Purity: Min. 95%

Molecular weight: 206.17 g/mol

Ref: 3D-FF91778