CAS 870704-26-0

3-Cyclopropyl-1H-pyrazole-4-carboxylic acid

Description:

3-Cyclopropyl-1H-pyrazole-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a cyclopropyl group at the 3-position of the pyrazole ring contributes to its unique chemical properties, including potential steric effects and reactivity. The carboxylic acid functional group at the 4-position enhances its acidity and solubility in polar solvents, making it a versatile compound in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the cyclopropyl group and the carboxylic acid moiety. Overall, 3-Cyclopropyl-1H-pyrazole-4-carboxylic acid is a compound of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c10-7(11)5-3-8-9-6(5)4-1-2-4/h3-4H,1-2H2,(H,8,9)(H,10,11)

InChI key: InChIKey=BDRDAUXEHDELHS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=NNC1)C2CC2

Synonyms:

• 3-Cyclopropyl-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 3-cyclopropyl-
• 3-Cyclopropylpyrazole-4-carboxylic acid

5-Cyclopropyl-1h-pyrazole-4-carboxylic acid

CAS: 870704-26-0

Formula: C₇H₈N₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA004N9I

5-Cyclopropyl-1H-pyrazole-4-carboxylic acid

CAS: 870704-26-0

5-Cyclopropyl-1H-pyrazole-4-carboxylic acid

Purity: 95%

Molecular weight: 152.15g/mol

Ref: 54-OR902612

3-CYCLOPROPYL-1H-PYRAZOLE-4-CARBOXYLIC ACID

CAS: 870704-26-0

Formula: C₇H₈N₂O₂

Purity: 96%

Molecular weight: 152.153

Ref: 10-F501108

3-Cyclopropylpyrazole-4-carboxylic acid

CAS: 870704-26-0

3-Cyclopropylpyrazole-4-carboxylic acid is a white to pale yellow solid that can be synthesized from ammonium formate. 3-Cyclopropylpyrazole-4-carboxylic acid has been shown to copolymerize with acrylic acid and other monomers to produce polymers with desirable properties, such as high performance liquid chromatography (HPLC) elution times and enhanced chemiluminescence reactions. 3-Cyclopropylpyrazole-4-carboxylic acid also has a high affinity for chloride ions, which enables it to be used in the purification of liquid chromatography columns by elution. The compound may enhance neurotransmitter activity and inhibit the production of trimethylamine in the gut, suggesting that it may have therapeutic potential for neurological disorders.

Formula: C₇H₈N₂O₂

Purity: Min. 95%

Molecular weight: 152.15 g/mol

Ref: 3D-VJB70426