
CAS 870704-27-1
:5-(Chloromethyl)-4-isoxazolecarboxylic acid
Description:
5-(Chloromethyl)-4-isoxazolecarboxylic acid is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. The presence of the chlorine atom can also influence the compound's biological activity and interactions with other molecules. Typically, compounds like this are of interest in medicinal chemistry and agrochemicals due to their potential as intermediates in the synthesis of pharmaceuticals or as active ingredients in crop protection products. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 5-(Chloromethyl)-4-isoxazolecarboxylic acid represents a versatile building block in organic synthesis.
Formula:C5H4ClNO3
InChI:InChI=1S/C5H4ClNO3/c6-1-4-3(5(8)9)2-7-10-4/h2H,1H2,(H,8,9)
InChI key:InChIKey=IENDPQHJPZEULX-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(C(O)=O)C=NO1
Synonyms:- 5-(Chloromethyl)isoxazole-4-carboxylic acid
- 4-Isoxazolecarboxylic acid, 5-(chloromethyl)-
- 5-(Chloromethyl)-4-isoxazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
