CAS 870706-48-2

5-Bromo-4-chloro-7-(1-methylethyl)-7H-pyrrolo[2,3-d]pyrimidine

Description:

5-Bromo-4-chloro-7-(1-methylethyl)-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features bromine and chlorine substituents, contributing to its reactivity and potential biological activity. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the field of oncology or as kinase inhibitors, due to their ability to interact with biological targets. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be crucial for binding to biological macromolecules. Additionally, the compound's stability and solubility can be influenced by the halogen substituents and the overall electronic distribution within the molecule. As with many heterocycles, the synthesis and characterization of this compound are essential for understanding its potential applications in medicinal chemistry.

Formula: C₉H₉BrClN₃

InChI: InChI=1S/C9H9BrClN3/c1-5(2)14-3-6(10)7-8(11)12-4-13-9(7)14/h3-5H,1-2H3

InChI key: InChIKey=ARSZZBPXLBCJRY-UHFFFAOYSA-N

SMILES: C(C)(C)N1C=2C(C(Br)=C1)=C(Cl)N=CN2

Synonyms:

• 5-Bromo-4-chloro-7-(1-methylethyl)-7H-pyrrolo[2,3-d]pyrimidine
• 5-Bromo-4-chloro-7-isopropyl-7H-pyrrolo[2,3-d]pyrimidine
• 7H-Pyrrolo[2,3-d]pyrimidine, 5-bromo-4-chloro-7-(1-methylethyl)-

5-Bromo-4-chloro-7-isopropyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 870706-48-2

Formula: C₉H₉BrClN₃

Purity: 95%

Molecular weight: 274.5449

Ref: IN-DA00GUQ1