CAS 87071-16-7
:Arclofenin
Description:
Arclofenin, with the CAS number 87071-16-7, is a chemical compound that belongs to the class of phenolic compounds. It is primarily recognized for its application in the field of pharmaceuticals, particularly as an anti-inflammatory agent. The substance exhibits properties that can modulate biological pathways, making it of interest in therapeutic contexts. Arclofenin is characterized by its specific molecular structure, which includes a phenolic ring that contributes to its reactivity and interaction with biological systems. The compound is typically studied for its efficacy, safety profile, and potential side effects in clinical settings. As with many chemical substances, its handling requires adherence to safety protocols due to potential toxicity or environmental impact. Further research continues to explore its mechanisms of action and broader applications in medicine.
Formula:C19H17ClN2O6
InChI:InChI=1/C19H17ClN2O6/c20-13-6-7-15(14(8-13)19(28)12-4-2-1-3-5-12)21-16(23)9-22(10-17(24)25)11-18(26)27/h1-8H,9-11H2,(H,21,23)(H,24,25)(H,26,27)
SMILES:c1ccc(cc1)C(=O)c1cc(ccc1N=C(CN(CC(=O)O)CC(=O)O)O)Cl
Synonyms:- Arclofenin [USAN:INN]
- ((((2-Benzoyl-4-chlorophenyl)carbamoyl)methyl)imino)diacetic acid
- Arclofeninum
- Arclophenin
- Glycine, N-(2-((2-benzoyl-4-chlorophenyl)amino)-2-oxoethyl)-N-(carboxymethyl)-
- N-((2-Benzoyl-4-chlorphenyl)carbamoylmethyl)imidnodiessigsaeure
- Unii-Rn145A0Svl
- 2,2'-({2-[(2-Benzoyl-4-Chlorophenyl)Amino]-2-Oxoethyl}Imino)Diacetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Arclofenin
CAS:<p>Arclofenin ia a diagnostic aid used to determine hepatic function.</p>Formula:C19H17ClN2O6Color and Shape:SolidMolecular weight:404.8

