CAS 870718-06-2

(2,4-Difluoro-3-formylphenyl)boronic acid

Description:

(2,4-Difluoro-3-formylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two fluorine atoms and an aldehyde group. The molecular structure features a boron atom bonded to a hydroxyl group and an aryl group, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. The difluorophenyl moiety contributes to its unique electronic properties, potentially influencing its reactivity and solubility. This compound is typically used in the development of pharmaceuticals and agrochemicals, as well as in the synthesis of complex organic molecules. Its boronic acid functionality allows for the formation of stable complexes with diols, which is useful in various applications, including sensor technology and drug delivery systems. Safety data should be reviewed before handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₇H₅BF₂O₃

InChI: InChI=1S/C7H5BF2O3/c9-6-2-1-5(8(12)13)7(10)4(6)3-11/h1-3,12-13H

InChI key: InChIKey=PVAWONNALJEQJH-UHFFFAOYSA-N

SMILES: C(=O)C1=C(F)C(B(O)O)=CC=C1F

Synonyms:

• (2,4-Difluoro-3-formylphenyl)boronic acid
• Boronic acid, (2,4-difluoro-3-formylphenyl)-
• 2,4-Difluoro-3-formylbenzeneboronic acid
• Boronic acid, B-(2,4-difluoro-3-formylphenyl)-
• B-(2,4-Difluoro-3-formylphenyl)boronic acid

(2,4-Difluoro-3-formylphenyl)boronic acid

CAS: 870718-06-2

Formula: C₇H₅BF₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 185.9206

Ref: IN-DA0032BX

2,4-Difluoro-3-formylphenylboronic acid

CAS: 870718-06-2

2,4-Difluoro-3-formylphenylboronic acid

Formula: C₇H₅BF₂O₃

Purity: 99%

Color and Shape: off-white solid

Molecular weight: 185.92g/mol

Ref: 54-PC412092

(2,4-Difluoro-3-formylphenyl)boronic acid

CAS: 870718-06-2

Formula: C₇H₅BF₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 185.92

Ref: 10-F323809

2,4-Difluoro-3-formylphenylboronic acid

Controlled Product

CAS: 870718-06-2

Stability Moisture Sensitive
Applications 2,4-Difluoro-3-formylphenylboronic acid

Formula: C₇H₅BF₂O₃

Color and Shape: Neat

Molecular weight: 185.92

Ref: TR-D446118