
CAS 870718-08-4
:B-[4-[(3,5-Dimethoxyphenyl)methoxy]phenyl]boronic acid
Description:
B-[4-[(3,5-Dimethoxyphenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a biphenyl structure with methoxy substituents that enhance its solubility and reactivity. The presence of the boronic acid moiety allows it to participate in Suzuki coupling reactions, a widely used method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the dimethoxyphenyl groups contribute to the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. Overall, B-[4-[(3,5-Dimethoxyphenyl)methoxy]phenyl]boronic acid is a versatile compound with significant implications in both synthetic and pharmaceutical chemistry.
Formula:C15H17BO5
InChI:InChI=1S/C15H17BO5/c1-19-14-7-11(8-15(9-14)20-2)10-21-13-5-3-12(4-6-13)16(17)18/h3-9,17-18H,10H2,1-2H3
InChI key:InChIKey=VGULDMBLXOLKDX-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(B(O)O)C=C1)C2=CC(OC)=CC(OC)=C2
Synonyms:- Boronic acid, [4-[(3,5-dimethoxyphenyl)methoxy]phenyl]-
- B-[4-[(3,5-Dimethoxyphenyl)methoxy]phenyl]boronic acid
- Boronic acid, B-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
