CAS 870765-38-1
:1-(2,3-dichlorophenyl)-4-(4-hydroxybutyl)piperazine
Description:
1-(2,3-Dichlorophenyl)-4-(4-hydroxybutyl)piperazine, identified by its CAS number 870765-38-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered cyclic amine, substituted with a dichlorophenyl group and a hydroxybutyl group. The presence of the dichlorophenyl moiety suggests potential biological activity, as halogenated phenyl groups are often associated with pharmacological properties. The hydroxybutyl substituent may enhance solubility and influence the compound's interaction with biological targets. This compound may exhibit properties such as moderate to high polarity due to the hydroxyl group, which can participate in hydrogen bonding. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies and safety assessments.
Formula:C14H20Cl2N2O
InChI:InChI=1/C14H20Cl2N2O/c15-12-4-3-5-13(14(12)16)18-9-7-17(8-10-18)6-1-2-11-19/h3-5,19H,1-2,6-11H2
SMILES:C(CCO)CN1CCN(CC1)c1cccc(c1Cl)Cl
Synonyms:- 4-[4-(2,3-Dichlorophenyl)Piperazin-1-Yl]Butan-1-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
