CAS 870773-76-5

Benzoic acid, 4-[4-(2-butoxyethoxy)-5-methyl-2-thiazolyl]-2-fluoro-

Description:

Benzoic acid, 4-[4-(2-butoxyethoxy)-5-methyl-2-thiazolyl]-2-fluoro- is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a thiazole ring, and an ether functional group. The presence of the 2-fluoro substituent indicates that a fluorine atom is attached to the benzene ring, which can influence the compound's reactivity and solubility. The thiazole ring contributes to the compound's biological activity, often associated with various pharmacological properties. The butoxyethoxy group enhances the compound's solubility in organic solvents, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. This compound may exhibit specific interactions with biological targets due to its unique functional groups, which can be explored for therapeutic purposes. As with many chemical substances, safety data and handling precautions should be considered, as they can vary based on the compound's properties and intended use.

Formula: C₁₇H₂₀FNO₄S

InChI: InChI=1S/C17H20FNO4S/c1-3-4-7-22-8-9-23-15-11(2)24-16(19-15)12-5-6-13(17(20)21)14(18)10-12/h5-6,10H,3-4,7-9H2,1-2H3,(H,20,21)

InChI key: HSAOETBFVAWNRP-UHFFFAOYSA-N

SMILES: CCCCOCCOC1=C(SC(=N1)C2=CC(=C(C=C2)C(=O)O)F)C

4-(4-(2-butoxyethoxy)-5-methylthiazol-2-yl)-2-fluorobenzoic acid

CAS: 870773-76-5

Formula: C₁₇H₂₀FNO₄S

Purity: 99.64%

Molecular weight: 353.4084

Ref: IN-DA004GDL

AC-261066

CAS: 870773-76-5

AC-261066

Formula: C₁₇H₂₀FNO₄S

Purity: ≥98%

Molecular weight: 353.41

Ref: 54-BUP04903

AC-261066

CAS: 870773-76-5

4-(4-(2-Butoxyethoxy)-5-methylthiazol-2-yl)-2-fluorobenzoic acid

Formula: C₁₇H₂₀FNO₄S

Purity: 97%

Molecular weight: 353.41

Ref: IN-DG559254

AC 261066

Controlled Product

CAS: 870773-76-5

Formula: C₁₇H₂₀FNO₄S

Color and Shape: Neat

Molecular weight: 353.408

Ref: TR-A192213

AC-261066

CAS: 870773-76-5

AC-261066 is an orally available and isoform-selective agonist of RARβ2 with a pEC50 of 8.0.

Formula: C₁₇H₂₀FNO₄S

Purity: 99.64%

Color and Shape: Solid

Molecular weight: 353.41

Ref: TM-T14089