CAS 870774-25-7
:4-(1-Naphthyl)phenylboronic acid
Description:
4-(1-Naphthyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure, specifically featuring a naphthyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as methanol and dimethyl sulfoxide. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, making it useful in various applications such as organic synthesis, medicinal chemistry, and materials science. The compound is often utilized in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, its structural features may contribute to its potential biological activity, making it a subject of interest in drug development. Safety considerations should be taken into account when handling this compound, as with many organoboron compounds, due to potential irritant properties. Overall, 4-(1-Naphthyl)phenylboronic acid is a versatile compound with significant relevance in both academic and industrial chemistry.
Formula:C16H13BO2
InChI:InChI=1/C16H13BO2/c18-17(19)14-10-8-13(9-11-14)16-7-3-5-12-4-1-2-6-15(12)16/h1-11,18-19H
SMILES:c1ccc2c(c1)cccc2c1ccc(cc1)B(O)O
Synonyms:- [4-(1-Naphthyl)phenyl]boronic acid
- boronic acid, B-[4-(1-naphthalenyl)phenyl]-
- 4-(Naphthalen-1-yl)phenylboronic acid
- 4-(1-Naphthyl)benzeneboronic Acid
- 4-(Naphthalene-1-Yl)Phenylboronic Acid
- 4-(Naphthyl-1-yl)phenyl boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(1-Naphthyl)benzeneboronic acid
CAS:Formula:C16H13BO2Purity:97%Color and Shape:SolidMolecular weight:248.08424-(Naphth-1-yl)benzeneboronic acid
CAS:4-(Naphth-1-yl)benzeneboronic acidFormula:C16H13BO2Purity:≥95%Color and Shape: white solidMolecular weight:248.08g/mol4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C16H13BO2Color and Shape:White to Light yellow powder to crystalMolecular weight:248.094-(1-Naphthyl)phenylboronic acid
CAS:Formula:C16H13BO2Purity:97%Color and Shape:SolidMolecular weight:248.09




