CAS 870777-19-8

(2-butoxy-6-fluorophenyl)boronic acid

Description:

(2-butoxy-6-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a butoxy group, which enhances its solubility in organic solvents, and a fluorine atom on the phenyl ring, which can influence its electronic properties and reactivity. The boronic acid moiety contributes to its acidity, allowing it to participate in acid-base reactions. Additionally, the presence of the fluorine substituent can affect the compound's lipophilicity and biological activity. Overall, (2-butoxy-6-fluorophenyl)boronic acid is a versatile building block in organic synthesis and medicinal chemistry, often utilized in the development of pharmaceuticals and agrochemicals due to its unique reactivity and functionalization potential.

Formula: C₁₀H₁₄BFO₃

InChI: InChI=1/C10H14BFO3/c1-2-3-7-15-9-6-4-5-8(12)10(9)11(13)14/h4-6,13-14H,2-3,7H2,1H3

SMILES: CCCCOc1cccc(c1B(O)O)F

2-Butoxy-6-fluorophenylboronic acid

CAS: 870777-19-8

Formula: C₁₀H₁₄BFO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.0258

Ref: IN-DA003GTI

2-Butoxy-6-fluorophenylboronic acid

CAS: 870777-19-8

2-Butoxy-6-fluorophenylboronic acid

Purity: ≥95%

Molecular weight: 212.03g/mol

Ref: 54-PC412096

(2-Butoxy-6-fluorophenyl)boronic acid

CAS: 870777-19-8

Formula: C₁₀H₁₄BFO₃

Purity: ≥95%

Molecular weight: 212.03

Ref: 10-F338094