CAS 870777-21-2

{2-[(2-chlorobenzyl)oxy]phenyl}boronic acid

Description:

{2-[(2-chlorobenzyl)oxy]phenyl}boronic acid, with the CAS number 870777-21-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 2-chlorobenzyl ether. This compound typically exhibits properties such as moderate solubility in polar organic solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of reversible complexes with diols, making it useful in sensing applications and in the development of drug delivery systems. Additionally, the presence of the chlorobenzyl group may influence its biological activity and interaction with other molecules. Overall, this compound is of interest in both synthetic organic chemistry and potential pharmaceutical applications due to its unique structural features and reactivity.

Formula: C₁₃H₁₂BClO₃

InChI: InChI=1/C13H12BClO3/c15-12-7-3-1-5-10(12)9-18-13-8-4-2-6-11(13)14(16)17/h1-8,16-17H,9H2

SMILES: c1ccc(c(c1)COc1ccccc1B(O)O)Cl

Synonyms:

• boronic acid, B-[2-[(2-chlorophenyl)methoxy]phenyl]-
• {2-[(2-Chlorobenzyl)oxy]phenyl}boronic acid

(2-((2-Chlorobenzyl)oxy)phenyl)boronic acid

CAS: 870777-21-2

Formula: C₁₃H₁₂BClO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 262.4966

Ref: IN-DA003ERA

2-(2'-Chlorobenzyloxy)phenylboronic acid

CAS: 870777-21-2

2-(2'-Chlorobenzyloxy)phenylboronic acid

Purity: 98%

Molecular weight: 262.50g/mol

Ref: 54-OR360903

(2-((2-Chlorobenzyl)oxy)phenyl)boronic acid

CAS: 870777-21-2

Purity: 95%

Molecular weight: 262.5

Ref: 10-F693986