CymitQuimica logo

CAS 870777-32-5

:

(4,5-difluoro-2-methoxyphenyl)boronic acid

Description:
(4,5-Difluoro-2-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. The molecule features two fluorine atoms at the 4 and 5 positions of the aromatic ring, which can influence its electronic properties and reactivity. The methoxy group at the 2 position enhances the solubility and stability of the compound in various solvents. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis, particularly in Suzuki coupling reactions. This compound may exhibit unique properties due to the presence of fluorine, such as increased lipophilicity and altered reactivity compared to its non-fluorinated counterparts. Additionally, the presence of the boronic acid group allows for potential applications in medicinal chemistry, materials science, and as a building block in the synthesis of more complex molecules. Overall, (4,5-difluoro-2-methoxyphenyl)boronic acid is a versatile compound with significant implications in various fields of chemistry.
Formula:C7H7BF2O3
InChI:InChI=1/C7H7BF2O3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3,11-12H,1H3
InChI key:InChIKey=ISQCHQGYKNHYGP-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(OC)C=C(F)C(F)=C1
Synonyms:
  • Boronic acid, B-(4,5-difluoro-2-methoxyphenyl)-
  • (4,5-Difluoro-2-methoxyphenyl)boronic acid
  • B-(4,5-Difluoro-2-methoxyphenyl)boronic acid
  • Boronic acid, (4,5-difluoro-2-methoxyphenyl)-
  • 2-Borono-4,5-difluoroanisole
  • 4,5-Difluoro-2-methoxyphenylboronic acid(contains varying amounts of Anhydride)
  • 4,5-Difluoro-2-methoxybenzeneboronic acid 98%
Found 4 products.