CAS 870778-94-2: B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid

Description:B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid, with the CAS number 870778-94-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity with various electrophiles due to the boronic acid moiety, which can form reversible covalent bonds with diols. The presence of the methyl and isopropoxy substituents on the phenyl ring can influence its steric and electronic properties, enhancing its utility in organic synthesis and medicinal chemistry. Boronic acids are known for their role in Suzuki coupling reactions, making this compound valuable in the synthesis of complex organic molecules. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical applications. Overall, B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid is a versatile building block in chemical research and development.

Formula:C₁₁H₁₇BO₃

InChI:InChI=1S/C11H17BO3/c1-8(2)7-15-11-5-4-9(3)6-10(11)12(13)14/h4-6,8,13-14H,7H2,1-3H3

InChI key:InChIKey=DJGCEUCMCLMRKN-UHFFFAOYSA-N

SMILES:OB(O)C1=CC(=CC=C1OCC(C)C)C

Synonyms:
2-Isobutoxy-5-methylphenylboronic acid
B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid
Boronic acid, [5-methyl-2-(2-methylpropoxy)phenyl]-
[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid
Boronic acid, B-[5-methyl-2-(2-methylpropoxy)phenyl]-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(2-Isobutoxy-5-methylphenyl)boronic acid REF: IN-DA003HH2CAS: 870778-94-2	95%	65.00 €~308.00 €	Tue 29 Apr 25
2-Isobutoxy-5-methylphenylboronic acid REF: 54-OR361284CAS: 870778-94-2	- - -	62.00 €~546.00 €	Mon 28 Apr 25
(2-Isobutoxy-5-methylphenyl)boronic acid REF: 10-F691482CAS: 870778-94-2	95%	To inquire	Wed 07 May 25
2-Isobutoxy-5-methylphenylboronic acid REF: 3D-VJB77894CAS: 870778-94-2	Min. 95%	- - -	Discontinued product