CymitQuimica logo

CAS 870778-94-2

:

B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid

Description:
B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid, with the CAS number 870778-94-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity with various electrophiles due to the boronic acid moiety, which can form reversible covalent bonds with diols. The presence of the methyl and isopropoxy substituents on the phenyl ring can influence its steric and electronic properties, enhancing its utility in organic synthesis and medicinal chemistry. Boronic acids are known for their role in Suzuki coupling reactions, making this compound valuable in the synthesis of complex organic molecules. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical applications. Overall, B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid is a versatile building block in chemical research and development.
Formula:C11H17BO3
InChI:InChI=1S/C11H17BO3/c1-8(2)7-15-11-5-4-9(3)6-10(11)12(13)14/h4-6,8,13-14H,7H2,1-3H3
InChI key:InChIKey=DJGCEUCMCLMRKN-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=C(B(O)O)C=C(C)C=C1
Synonyms:
  • 2-Isobutoxy-5-methylphenylboronic acid
  • B-[5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid
  • Boronic acid, [5-methyl-2-(2-methylpropoxy)phenyl]-
  • [5-Methyl-2-(2-methylpropoxy)phenyl]boronic acid
  • Boronic acid, B-[5-methyl-2-(2-methylpropoxy)phenyl]-
Found 4 products.