CAS 870778-99-7

B-[3-[(2-Chlorophenyl)methoxy]-2,6-difluorophenyl]boronic acid

Description:

B-[3-[(2-Chlorophenyl)methoxy]-2,6-difluorophenyl]boronic acid, with the CAS number 870778-99-7, is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a complex aromatic structure, including a difluorophenyl group and a chlorophenyl moiety, which contribute to its chemical reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the compound. Boronic acids are also recognized for their role in Suzuki coupling reactions, making this compound valuable in organic synthesis. Additionally, the methoxy group can influence the electronic properties and solubility of the molecule. Overall, this compound's unique structural features suggest potential utility in various chemical applications, including drug discovery and material science.

Formula: C₁₃H₁₀BClF₂O₃

InChI: InChI=1S/C13H10BClF2O3/c15-9-4-2-1-3-8(9)7-20-11-6-5-10(16)12(13(11)17)14(18)19/h1-6,18-19H,7H2

InChI key: InChIKey=VJXYERSPXBFRTA-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=C(F)C(B(O)O)=C(F)C=C2

Synonyms:

• Boronic acid, B-[3-[(2-chlorophenyl)methoxy]-2,6-difluorophenyl]-
• Boronic acid, [3-[(2-chlorophenyl)methoxy]-2,6-difluorophenyl]-
• (3-((2-Chlorobenzyl)oxy)-2,6-difluorophenyl)boronic acid
• 2,6-Difluoro-3-(2′-chlorobenzyloxy)phenylboronic acid
• B-[3-[(2-Chlorophenyl)methoxy]-2,6-difluorophenyl]boronic acid

2,6-Difluoro-3-(2'-chlorobenzyloxy)phenylboronic acid

CAS: 870778-99-7

Formula: C₁₃H₁₀BClF₂O₃

Molecular weight: 298.4775

Ref: IN-DA003G40

2,6-Difluoro-3-(2'-chlorobenzyloxy)phenylboronic acid

CAS: 870778-99-7

2,6-Difluoro-3-(2'-chlorobenzyloxy)phenylboronic acid

Purity: ≥95%

Molecular weight: 298.48g/mol

Ref: 54-PC412352