CAS 87081-56-9
:(3S,4S,5E)-6-(4-Chloro-3-methoxyphenyl)-4-methoxy-2-[(E)-methoxymethylene]-3-methyl-5-hexenoic acid methyl ester
Formula:C18H23ClO5
InChI:InChI=1/C18H23ClO5/c1-12(14(11-21-2)18(20)24-5)16(22-3)9-7-13-6-8-15(19)17(10-13)23-4/h6-12,16H,1-5H3/b9-7+,14-11+/t12-,16-/m0/s1
Synonyms:- 5-Hexenoic acid, 6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylene)-3-methyl-, methyl ester, (2E,3S,4S,5E)-
- Oudermansin B
- (3S,4S,5E)-6-(4-Chloro-3-methoxyphenyl)-4-methoxy-2-[(E)-methoxymethylene]-3-methyl-5-hexenoic acid methyl ester
- Oudemansin B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oudermansin B
CAS:Oudermansin B is an antibiotic that targets fungi by inhibiting the synthesis of proteins, RNA, and DNA.Formula:C18H23ClO5Color and Shape:SolidMolecular weight:354.83
