CAS 870812-93-4
:Phenylmethyl N-[(1R)-3-(4-morpholinyl)-3-oxo-1-[(phenylthio)methyl]propyl]carbamate
Description:
Phenylmethyl N-[(1R)-3-(4-morpholinyl)-3-oxo-1-[(phenylthio)methyl]propyl]carbamate, identified by its CAS number 870812-93-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a carbamate functional group, a morpholine ring, and a phenylthio moiety. This compound typically exhibits properties associated with carbamates, such as potential biological activity, including enzyme inhibition or modulation. Its morpholine component may contribute to its solubility and interaction with biological targets. The presence of the phenylthio group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The stereochemistry indicated by the (1R) configuration may influence its biological activity and pharmacokinetics. As with many synthetic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH and temperature. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C22H26N2O4S
InChI:InChI=1S/C22H26N2O4S/c25-21(24-11-13-27-14-12-24)15-19(17-29-20-9-5-2-6-10-20)23-22(26)28-16-18-7-3-1-4-8-18/h1-10,19H,11-17H2,(H,23,26)/t19-/m1/s1
InChI key:InChIKey=RHPYQTFRGJXXJX-LJQANCHMSA-N
SMILES:[C@@H](CC(=O)N1CCOCC1)(CSC2=CC=CC=C2)NC(OCC3=CC=CC=C3)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Benzyloxycarbonyl-4-[(3R)-3-amino-1-oxo-4-(phenylthio)butyl]morpholine
CAS:Applications Intermediate in the production of cell death regulators and apoptosis promoters.
Formula:C22H26N2O4SColor and Shape:Off White OilyMolecular weight:414.52
