CymitQuimica logo

CAS 870822-77-8

:

Boronic acid,B-(2,2,4,4-tetrafluoro-4H-1,3-benzodioxin-6-yl)-

Description:
Boronic acid, specifically B-(2,2,4,4-tetrafluoro-4H-1,3-benzodioxin-6-yl)-, is an organoboron compound characterized by the presence of a boron atom bonded to a hydroxyl group and a substituted aromatic ring. This compound features a tetrafluorinated benzodioxin moiety, which contributes to its unique chemical properties, including enhanced stability and reactivity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications such as organic synthesis, drug development, and materials science. The presence of fluorine atoms in the structure often imparts increased lipophilicity and can influence the compound's biological activity. Additionally, boronic acids can participate in Suzuki coupling reactions, which are essential for constructing complex organic molecules. Overall, this compound's distinctive structure and reactivity profile make it a significant entity in the field of organic chemistry and medicinal chemistry.
Formula:C8H5BF4O4
InChI:InChI=1S/C8H5BF4O4/c10-7(11)5-3-4(9(14)15)1-2-6(5)16-8(12,13)17-7/h1-3,14-15H
InChI key:InChIKey=HLUVHDQKBZFLJY-UHFFFAOYSA-N
SMILES:FC1(F)C=2C(OC(F)(F)O1)=CC=C(B(O)O)C2
Synonyms:
  • (2,2,4,4-Tetrafluoro-2,4-dihydro-1,3-benzodioxin-6-yl)boronic acid
  • (2,2,4,4-Tetrafluoro-4H-1,3-benzodioxin-6-yl)boronic acid
  • B-(2,2,4,4-Tetrafluoro-4H-1,3-benzodioxin-6-yl)boronic acid
  • Boronic acid, (2,2,4,4-tetrafluoro-4H-1,3-benzodioxin-6-yl)-
  • Boronicacid, (2,2,4,4-tetrafluoro-4H-1,3-benzodioxin-6-yl)- (9CI)
  • Boronic acid, B-(2,2,4,4-tetrafluoro-4H-1,3-benzodioxin-6-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.