CymitQuimica logo

CAS 870822-78-9

:

Boronic acid,B-[5-chloro-2-(trifluoromethoxy)phenyl]-

Description:
Boronic acid, B-[5-chloro-2-(trifluoromethoxy)phenyl]- (CAS 870822-78-9), is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenyl ring that is substituted with a chlorine atom and a trifluoromethoxy group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity in various chemical reactions, particularly in Suzuki coupling reactions, which are valuable in organic synthesis for forming carbon-carbon bonds. The presence of the trifluoromethoxy group enhances its electronic properties, making it a useful building block in the development of pharmaceuticals and agrochemicals. Additionally, the chlorine substituent can influence the compound's reactivity and stability. Overall, this boronic acid derivative is significant in synthetic chemistry due to its functional versatility and the ability to participate in diverse chemical transformations.
Formula:C7H5BClF3O3
InChI:InChI=1S/C7H5BClF3O3/c9-4-1-2-6(15-7(10,11)12)5(3-4)8(13)14/h1-3,13-14H
InChI key:UCZWBMQPOWTYNS-UHFFFAOYSA-N
SMILES:B(C1=C(C=CC(=C1)Cl)OC(F)(F)F)(O)O
Synonyms:
  • Boronicacid, [5-chloro-2-(trifluoromethoxy)phenyl]- (9CI)
  • [5-Chloro-2-(trifluoromethoxy)phenyl]boronic acid
  • Boronic acid, B-[5-chloro-2-(trifluoromethoxy)phenyl]-
Found 4 products.