CymitQuimica logo

CAS 870822-85-8

:

2-(6-Chloro-2-naphthalenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(6-Chloro-2-naphthalenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound is notable for its potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds through cross-coupling reactions, such as Suzuki-Miyaura coupling. The presence of the chloro-substituted naphthalene moiety enhances its reactivity and solubility in organic solvents, making it a valuable intermediate in the synthesis of complex organic molecules. Additionally, the tetramethyl groups contribute to the stability of the boron center and influence the electronic properties of the compound. Its CAS number, 870822-85-8, allows for easy identification and retrieval of information regarding its properties and safety data. Overall, this compound exemplifies the versatility of boron-containing compounds in modern synthetic chemistry.
Formula:C16H18BClO2
InChI:InChI=1S/C16H18BClO2/c1-15(2)16(3,4)20-17(19-15)13-7-5-12-10-14(18)8-6-11(12)9-13/h5-10H,1-4H3
InChI key:InChIKey=ZBKPIWYTBXVKAC-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC3=C(C=C2)C=C(Cl)C=C3
Synonyms:
  • 1,3,2-Dioxaborolane, 2-(6-chloro-2-naphthalenyl)-4,4,5,5-tetramethyl-
  • 2-(6-Chloro-2-naphthyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-(6-Chloro-2-naphthalenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.