CAS 870823-12-4
:N-(4-{(1S)-1-[3-(3,5-dichlorophenyl)-5-(6-methoxynaphthalen-2-yl)-1H-pyrazol-1-yl]ethyl}benzoyl)-beta-alanine
Description:
N-(4-{(1S)-1-[3-(3,5-dichlorophenyl)-5-(6-methoxynaphthalen-2-yl)-1H-pyrazol-1-yl]ethyl}benzoyl)-beta-alanine is a complex organic compound characterized by its multi-functional structure, which includes a pyrazole ring, a benzoyl group, and a beta-alanine moiety. This compound exhibits properties typical of pharmaceutical agents, potentially including anti-inflammatory or analgesic effects, due to the presence of the pyrazole and aromatic systems. The presence of the dichlorophenyl and methoxynaphthalene groups suggests that it may have significant lipophilicity, influencing its solubility and bioavailability. The stereochemistry indicated by the (1S) configuration may also play a crucial role in its biological activity, as stereoisomers can exhibit different pharmacological profiles. Additionally, the compound's molecular interactions, such as hydrogen bonding and π-π stacking, could affect its binding affinity to biological targets. Overall, this substance represents a class of compounds that may be of interest in medicinal chemistry and drug development.
Formula:C32H27Cl2N3O4
InChI:InChI=1/C32H27Cl2N3O4/c1-19(20-3-5-21(6-4-20)32(40)35-12-11-31(38)39)37-30(18-29(36-37)25-14-26(33)17-27(34)15-25)24-8-7-23-16-28(41-2)10-9-22(23)13-24/h3-10,13-19H,11-12H2,1-2H3,(H,35,40)(H,38,39)/t19-/m0/s1
SMILES:C[C@@H](c1ccc(cc1)C(=O)NCCC(=O)O)n1c(cc(c2cc(cc(c2)Cl)Cl)n1)c1ccc2cc(ccc2c1)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
b-Alanine, N-[4-[(1S)-1-[3-(3,5-dichlorophenyl)-5-(6-methoxy-2-naphthalenyl)-1H-pyrazol-1-yl]ethyl]benzoyl]-
CAS:Formula:C32H27Cl2N3O4Purity:98%Color and Shape:SolidMolecular weight:588.4805MK 0893
CAS:MK 0893 is a synthetic compound that acts as a liver X receptor (LXR) antagonist, which is derived from targeted drug discovery efforts focusing on nuclear receptor modulation. Its mode of action involves competitively inhibiting ATP binding at the LXR, effectively reducing the receptor's transcriptional activity. LXRs are nuclear receptors that regulate cholesterol, fatty acid, and glucose homeostasis by modulating gene expression.Formula:C32H27Cl2N3O4Purity:Min. 95%Molecular weight:588.48 g/molMK 0893
CAS:MK 0893 is a potent and selective Glucagon Receptor (GR) antagonist competitive, reversible cAMP activity, which attenuates blood glucose elevation.Formula:C32H27Cl2N3O4Purity:98.79%Color and Shape:SolidMolecular weight:588.48



