CAS 87084-40-0
:2-amino-1-(1H-indol-3-yl)ethanone
Description:
2-amino-1-(1H-indol-3-yl)ethanone, also known as tryptamine-2-carboxaldehyde, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features an amino group (-NH2) and a carbonyl group (C=O) attached to an ethane backbone, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. The presence of the indole moiety suggests potential interactions with biological systems, making it of interest in pharmacology and medicinal chemistry. Its CAS number, 87084-40-0, allows for easy identification in chemical databases. The compound may exhibit properties such as being a precursor in the synthesis of various pharmaceuticals or serving as a building block in organic synthesis. As with many amino ketones, it may also participate in reactions typical of carbonyl compounds, such as nucleophilic addition and condensation reactions.
Formula:C10H10N2O
InChI:InChI=1/C10H10N2O/c11-5-10(13)8-6-12-9-4-2-1-3-7(8)9/h1-4,6,12H,5,11H2
SMILES:c1ccc2c(c1)c(c[nH]2)C(=O)CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
