CAS 870841-69-3
:3-fluoro-4-(1H-imidazol-1-yl)benzaldehyde
Description:
3-Fluoro-4-(1H-imidazol-1-yl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and an imidazole ring. The presence of a fluorine atom at the meta position relative to the aldehyde group influences its reactivity and polarity, potentially enhancing its biological activity. The imidazole moiety contributes to the compound's ability to participate in hydrogen bonding and coordination with metal ions, making it of interest in medicinal chemistry and material science. This compound may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential applications in drug development due to its structural features. Its synthesis typically involves the introduction of the fluorine atom and the imidazole ring onto the benzaldehyde scaffold, which can be achieved through various organic reactions. Overall, 3-fluoro-4-(1H-imidazol-1-yl)benzaldehyde represents a versatile building block in the synthesis of more complex molecules.
Formula:C10H7FN2O
InChI:InChI=1/C10H7FN2O/c11-9-5-8(6-14)1-2-10(9)13-4-3-12-7-13/h1-7H
SMILES:c1cc(c(cc1C=O)F)n1ccnc1
Synonyms:- 3-Fluor-4-(1H-imidazol-1-yl)benzaldehyd
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.