CAS 870849-56-2
:4-Fluoro-3-methoxy-α-methylbenzenemethanol
Description:
4-Fluoro-3-methoxy-α-methylbenzenemethanol, identified by its CAS number 870849-56-2, is an organic compound characterized by the presence of a fluorine atom, a methoxy group, and a hydroxymethyl group attached to a benzene ring. This compound features a substituted aromatic structure, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The fluorine atom can enhance the lipophilicity and metabolic stability of the molecule, while the methoxy group may influence its electronic properties and solubility. The hydroxymethyl group introduces a functional site for further chemical modifications or interactions. Overall, the unique combination of these substituents can lead to interesting biological activities and make it a subject of interest in medicinal chemistry. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C9H11FO2
InChI:InChI=1S/C9H11FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-6,11H,1-2H3
InChI key:InChIKey=OGBGGCJKDXCBGP-UHFFFAOYSA-N
SMILES:O(C)C1=CC(C(C)O)=CC=C1F
Synonyms:- 1-(4-Fluoro-3-methoxyphenyl)ethan-1-ol
- 1-(4-Fluoro-3-methoxyphenyl)ethanol
- 4-Fluoro-3-methoxy-α-methylbenzenemethanol
- Benzenemethanol, 4-fluoro-3-methoxy-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.