CAS 870849-70-0

5-[(1S)-1-Aminoethyl]-2-fluorobenzonitrile

Description:

5-[(1S)-1-Aminoethyl]-2-fluorobenzonitrile, with the CAS number 870849-70-0, is a chemical compound characterized by its specific functional groups and structural features. It contains a fluorobenzene ring, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the aminoethyl group indicates that it can participate in various chemical reactions, including those involving amine functionalities. This compound is likely to exhibit polar characteristics due to the nitrile and amino groups, influencing its solubility in different solvents. Additionally, the stereochemistry of the aminoethyl group (noted as (1S)) suggests that it may have specific interactions in biological systems, potentially affecting its pharmacological properties. Overall, this compound's unique structure positions it as a candidate for further research in drug development or as a building block in organic synthesis. Its properties, including melting point, boiling point, and reactivity, would need to be evaluated through experimental methods for practical applications.

Formula: C₉H₉FN₂

InChI: InChI=1S/C9H9FN2/c1-6(12)7-2-3-9(10)8(4-7)5-11/h2-4,6H,12H2,1H3/t6-/m0/s1

InChI key: InChIKey=GLURPDBYZSVCJQ-LURJTMIESA-N

SMILES: C(#N)C1=CC([C@H](C)N)=CC=C1F

Synonyms:

• 5-((1S)-Aminoethyl)-2-fluorobenzonitrile
• 5-[(1S)-1-Aminoethyl]-2-fluorbenzonitril
• 5-[(1S)-1-aminoethyl]-2-fluorobenzonitrile
• Benzonitrile, 5-[(1S)-1-aminoethyl]-2-fluoro-

(S)-5-(1-Aminoethyl)-2-fluorobenzonitrile

CAS: 870849-70-0

(S)-5-(1-Aminoethyl)-2-fluorobenzonitrile

Purity: 95%

Molecular weight: 164.18g/mol

Ref: 54-PC1007324