CymitQuimica logo

CAS 87095-74-7

:

5-Hydroxy-1,7-diphenyl-6-hepten-3-one

Description:
5-Hydroxy-1,7-diphenyl-6-hepten-3-one, with the CAS number 87095-74-7, is an organic compound characterized by its unique structure, which includes a heptenone backbone with hydroxyl and diphenyl substituents. This compound typically exhibits properties associated with both ketones and phenolic compounds, such as potential reactivity in various chemical reactions due to the presence of the carbonyl group and the hydroxyl group. It may display moderate solubility in organic solvents, influenced by its hydrophobic phenyl groups and polar hydroxyl group. The compound's structure suggests potential applications in organic synthesis, pharmaceuticals, or as a biochemical probe, although specific applications may vary based on its reactivity and biological activity. Additionally, its stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C19H20O2
InChI:InChI=1S/C19H20O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-11,13,18,20H,12,14-15H2/b13-11+/t18-/m0/s1
InChI key:NEQGOKAKPXXESR-YLZCUGDYSA-N
SMILES:C1=CC=C(C=C1)CCC(=O)C[C@H](/C=C/C2=CC=CC=C2)O
Found 9 products.