CAS 87096-84-2
:neuromedin B
Description:
Neuromedin B is a neuropeptide that plays a significant role in various physiological processes, including the regulation of smooth muscle contraction and modulation of neuroendocrine functions. It is composed of a sequence of amino acids and is classified as a member of the neuromedin family, which are involved in neurotransmission and signaling within the central nervous system. Neuromedin B primarily acts through specific receptors, influencing processes such as appetite regulation, stress response, and reproductive functions. The peptide is known to be involved in the pathophysiology of certain conditions, including obesity and anxiety disorders. Its structure typically includes a C-terminal amidation, which is crucial for its biological activity. Neuromedin B is synthesized in various tissues, including the brain and gastrointestinal tract, and its effects are mediated through interactions with G-protein coupled receptors. Research continues to explore its potential therapeutic applications, particularly in the context of metabolic and neuropsychiatric disorders.
Formula:C52H73N15O12S
InChI:InChI=1/C52H73N15O12S/c1-27(2)17-36(64-51(78)40(21-41(54)69)61-42(70)22-53)48(75)66-38(19-31-23-57-34-14-10-9-13-33(31)34)47(74)60-28(3)46(73)67-44(29(4)68)52(79)58-25-43(71)62-39(20-32-24-56-26-59-32)50(77)65-37(18-30-11-7-6-8-12-30)49(76)63-35(45(55)72)15-16-80-5/h6-14,23-24,26-29,35-40,44,57,68H,15-22,25,53H2,1-5H3,(H2,54,69)(H2,55,72)(H,56,59)(H,58,79)(H,60,74)(H,61,70)(H,62,71)(H,63,76)(H,64,78)(H,65,77)(H,66,75)(H,67,73)/t28-,29+,35-,36-,37?,38-,39-,40-,44-/m0/s1
Synonyms:- H-Gly-Asn-Leu-Trp-Ala-Thr-Gly-His-Phe-Met-NH2
- (2S)-2-[(2-aminoacetyl)amino]-N-[(1S)-1-[[(1S)-2-[[(1S)-2-[[(1S,2R)-1-[[2-[[(1S)-2-[[1-benzyl-2-[[(1S)-1-carbamoyl-3-methylsulfanyl-propyl]amino]-2-oxo-ethyl]amino]-1-(3H-imidazol-4-ylmethyl)-2-oxo-ethyl]amino]-2-oxo-ethyl]carbamoyl]-2-hydroxy-propyl]amino]-1-methyl-2-oxo-ethyl]amino]-1-(1H-indol-3-ylmethyl)-2-oxo-ethyl]carbamoyl]-3-methyl-butyl]butanediamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Neuromedin B
CAS:<p>For cellular and molecular biology applications</p>Formula:C52H73N15O12SColor and Shape:Lyophilized powderMolecular weight:1132.3Neuromedin B
CAS:NMB, a bombesin-linke peptide, binds to the bombesin receptors BRS1-4. NMB is expressed in the pituitary, brain, pancreas, adrenal and gastrointestinal tract. Its expression in adipose tissue appears to be regulated by changes in energy balance. NMB could inhibit food intake and modulates stress-related behavior.Formula:C52H73N15O12SPurity:97.4%Color and Shape:White PowderMolecular weight:1132.31Neuromedin B
CAS:Neuromedin B, a mammalian peptide related to bombesin, is found in the CNS and GI tract, originally purified from pig spinal cords.Formula:C52H73N15O12SPurity:99.39%Color and Shape:SolidMolecular weight:1132.29Neuromedin B (porcine)
CAS:<p>Custom research peptide; min purity 95%. For different specs please use the Peptide Quote Tool</p>Formula:C52H73N15O12SMolecular weight:1,132.3 g/molNeuromedin C (Human, Porcine, Canine)
CAS:<p>Neuromedin C (NMC) is a peptide that belongs to the family of neuromedin and is a potent activator of ion channels. It has been shown to be a ligand for opioid receptors, which may be due to its ability to inhibit the release of neurotransmitters such as acetylcholine and noradrenaline. Neuromedin C has also been shown to inhibit the binding of morphine-6 beta-glucuronide in rat brain synaptosomes. In addition, NMC has been reported as an inhibitor of cell proliferation and induce apoptosis in various cancer cells including colon and prostate cancers.</p>Formula:C50H73N17O11SPurity:Min. 95%Molecular weight:1,120.3 g/molNeuromedin B (Human, Porcine, Rat)
CAS:<p>Neuromedin B is a neuropeptide that has been shown to activate the TRPC ion channels in mammalian cells. It also has been shown to bind to receptors and have a potent effect on cell biology, as well as being used as a research tool for studying protein interactions. Neuromedin B is found in humans, pigs, and rats, where it is expressed primarily in the brain and gastrointestinal tract. This peptide has been shown to be an inhibitor of some types of ion channels.</p>Formula:C52H73N15O12SPurity:Min. 95%Molecular weight:1,132.3 g/molNeuromedin B trifluoroacetate salt
CAS:<p>Neuromedin B is a peptide hormone that is produced by the hypothalamus and regulates many physiological processes such as energy metabolism, appetite, and sleep. Neuromedin B is a member of the family of guanine nucleotide-binding proteins (G proteins) that bind to G protein-coupled receptors on the surface of cells. It has been shown to stimulate calcium release from intracellular stores in response to an increase in cytosolic Ca2+. Neuromedin B has been shown to have anti-inflammatory effects on infectious diseases such as meningitis, sepsis, and tuberculosis, which may be due to its ability to inhibit neutrophil migration. Neuromedin B also stimulates hippocampal formation activity in rats during the rotarod test, which may be due to its effects on dopamine release.</p>Formula:C52H73N15O12SPurity:Min. 95%Molecular weight:1,132.3 g/mol





