CAS 87099-50-1
:(5S,10R)-7,9-dibromo-N-(3-{2,6-dibromo-4-[2-({[(5S,10R)-7,9-dibromo-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-trien-3-yl]carbonyl}amino)-1-hydroxyethyl]phenoxy}-2-hydroxypropyl)-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-triene-3-carb
Description:
The chemical substance identified by the name "(5S,10R)-7,9-dibromo-N-(3-{2,6-dibromo-4-[2-({[(5S,10R)-7,9-dibromo-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-trien-3-yl]carbonyl}amino)-1-hydroxyethyl]phenoxy}-2-hydroxypropyl)-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-triene-3-carb" and CAS number "87099-50-1" is a complex organic compound characterized by its intricate structure, which includes multiple bromine substituents, hydroxyl groups, and a unique spirocyclic framework. This compound features a combination of heteroatoms, specifically oxygen and nitrogen, contributing to its potential biological activity. The presence of multiple functional groups suggests that it may exhibit significant reactivity and solubility in various solvents. Its stereochemistry, indicated by the specific configuration at several chiral centers, may influence its pharmacological properties and interactions with biological targets. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Further studies would be necessary to elucidate its specific properties, including stability, reactivity, and biological activity.
Formula:C31H30Br6N4O11
InChI:InChI=1/C31H30Br6N4O11/c1-48-24-16(34)5-30(26(44)21(24)36)7-18(40-51-30)28(46)38-9-13(42)11-50-23-14(32)3-12(4-15(23)33)20(43)10-39-29(47)19-8-31(52-41-19)6-17(35)25(49-2)22(37)27(31)45/h3-6,13,20,26-27,42-45H,7-11H2,1-2H3,(H,38,46)(H,39,47)/t13?,20?,26-,27-,30+,31+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isofistularin-3
CAS:Isofistularin-3 is a natural product that has been shown to be an apoptosis inducer in cancer cells. It has been shown to have the ability to induce autophagy and apoptosis in human immunodeficiency virus (HIV) cells. Isofistularin-3 inhibits HIV replication by preventing the expression of viral gene products, including Gag and Nef. Apoptosis induction may be due to Isofistularin-3's ability to inhibit cell proliferation, which is mediated through light exposure, or its ability to inhibit viral protein synthesis. Isofistularin-3 also has anti-inflammatory properties and can be used as a treatment for paraganglioma and other types of tumors.Formula:C31H30Br6N4O11Purity:Min. 95%Molecular weight:1,114 g/mol

