
CAS 87099-85-2
:Spicamycin
Description:
Spicamycin is an antibiotic compound that belongs to the class of macrolides, specifically derived from the fermentation of the bacterium *Streptomyces griseus*. It is characterized by its complex macrocyclic structure, which is typical of macrolide antibiotics, allowing it to inhibit bacterial protein synthesis by binding to the 50S ribosomal subunit. Spicamycin exhibits antibacterial activity primarily against Gram-positive bacteria and some Gram-negative strains, making it useful in treating various bacterial infections. Its mechanism of action involves interference with the translocation step of protein synthesis, ultimately leading to the inhibition of bacterial growth. Additionally, spicamycin has been studied for its potential immunosuppressive properties, which may have implications in therapeutic applications beyond its antibiotic effects. The compound is typically administered in a clinical setting, and its safety and efficacy profile is evaluated through rigorous clinical trials. As with many antibiotics, the emergence of resistance is a concern, necessitating careful use and ongoing research into its pharmacological properties and potential applications.
Formula:C30H51N7O7
InChI:InChI=1S/C30H51N7O7/c1-19(2)13-11-9-7-5-3-4-6-8-10-12-14-21(40)31-15-22(41)36-23-25(42)26(43)30(44-27(23)20(39)16-38)37-29-24-28(33-17-32-24)34-18-35-29/h17-20,23,25-27,30,38-39,42-43H,3-16H2,1-2H3,(H,31,40)(H,36,41)(H2,32,33,34,35,37)/t20-,23+,25+,26+,27-,30-/m0/s1
InChI key:InChIKey=YBZRLMLGUBIIDN-DUSHZQPUSA-N
SMILES:N(C1=C2C(N=CN2)=NC=N1)[C@H]3O[C@@]([C@H](CO)O)([C@H](NC(CNC(CCCCCCCCCCCCC(C)C)=O)=O)[C@@H](O)[C@H]3O)[H]
Synonyms:- 4-Deoxy-4-[[2-[(14-methyl-1-oxopentadecyl)amino]acetyl]amino]-N-1H-purin-6-yl-L-glycero-β-L-manno-heptopyranosylamine
- Spicamycin
- L-glycero-β-L-manno-Heptopyranosylamine, 4-deoxy-4-[[[(14-methyl-1-oxopentadecyl)amino]acetyl]amino]-N-1H-purin-6-yl-
- Spicamycin E
- L-glycero-β-L-manno-Heptopyranosylamine, 4-deoxy-4-[[2-[(14-methyl-1-oxopentadecyl)amino]acetyl]amino]-N-1H-purin-6-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Spicamycin
CAS:Spicamycin can be used as a potent inducer of differentiation of human myeloid leukemia cells (HL-60) and murine myeloid leukemia cells (M1).Formula:C30H51N7O7Color and Shape:SolidMolecular weight:621.77
