CAS 870997-87-8

N-Methyl-2-aminonicotinamide

Description:

N-Methyl-2-aminonicotinamide is a chemical compound that belongs to the class of nicotinamide derivatives. It features a pyridine ring, which is characteristic of nicotinic compounds, and contains both an amino group and a methyl group attached to the nitrogen atom. This structure contributes to its potential biological activity, particularly in relation to its role in cellular metabolism and as a precursor in the synthesis of various bioactive molecules. The compound is typically characterized by its solubility in polar solvents, which is influenced by the presence of the amino group. N-Methyl-2-aminonicotinamide may exhibit properties such as antioxidant activity and potential therapeutic effects, making it of interest in pharmaceutical research. Its CAS number, 870997-87-8, allows for precise identification in chemical databases and literature. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.

Formula: C₇H₉N₃O

InChI: InChI=1/C7H9N3O/c1-9-7(11)5-3-2-4-10-6(5)8/h2-4H,1H3,(H2,8,10)(H,9,11)

Synonyms:

• N-Methyl-2-aminopyridine-3-carboxamide
• 2-amino-N-methylpyridine-3-carboxamide

2-Amino-N-methylnicotinamide

CAS: 870997-87-8

Formula: C₇H₉N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 151.1659

Ref: IN-DA004UVX

2-Amino-N-methylpyridine-3-carboxamide

CAS: 870997-87-8

2-Amino-N-methylpyridine-3-carboxamide

Purity: 97%

Molecular weight: 151.16586g/mol

Ref: 54-OR91465

2-Amino-N-methylnicotinamide

CAS: 870997-87-8

Formula: C₇H₉N₃O

Purity: 97%

Molecular weight: 151.169

Ref: 10-F232328

2-Amino-N-methylpyridine-3-carboxamide

Controlled Product

CAS: 870997-87-8

Applications 2-amino-N-methylpyridine-3-carboxamide (cas# 870997-87-8) is a useful research chemical.

Formula: C₇H₉N₃O

Color and Shape: Neat

Molecular weight: 151.16

Ref: TR-A636380