CAS 871-95-4
:Dodecyldimethylphosphine oxide
Description:
Dodecyldimethylphosphine oxide (CAS 871-95-4) is an organophosphorus compound characterized by its long hydrophobic dodecyl chain and a polar phosphine oxide functional group. This amphiphilic nature allows it to act as a surfactant, facilitating the reduction of surface tension in various applications. The compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic tail. Dodecyldimethylphosphine oxide is known for its stability under a range of conditions, making it useful in formulations for detergents, emulsifiers, and dispersants. Additionally, it can serve as a ligand in coordination chemistry and has potential applications in the synthesis of nanoparticles. Safety considerations include handling it with care, as it may pose health risks upon exposure. Overall, its unique structural features contribute to its versatility in both industrial and research settings.
Formula:C14H31OP
InChI:InChI=1S/C14H31OP/c1-4-5-6-7-8-9-10-11-12-13-14-16(2,3)15/h4-14H2,1-3H3
InChI key:InChIKey=SIDULKZCBGMXJL-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)CCP(C)(C)=O
Synonyms:- 1-Dimethylphosphoryldodecane
- Dimethyllaurylphosphine oxide
- Dodecyl(Dimethyl)Phosphane Oxide
- Dodecyldimethylphosphine oxide
- Phosphine oxide, dodecyldimethyl-
- n-Dodecyldimethylphosphine oxide
- Dimethyldodecylphosphine oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
