CAS 87100-15-0
:Cyclohexylboronic acid pinacol ester
Description:
Cyclohexylboronic acid pinacol ester, with the CAS number 87100-15-0, is an organoboron compound characterized by the presence of a cyclohexyl group attached to a boron atom, which is further esterified with pinacol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its utility in organic synthesis, particularly in the formation of carbon-carbon bonds through Suzuki coupling reactions. Cyclohexylboronic acid pinacol ester exhibits moderate solubility in organic solvents such as dichloromethane and ether, while being less soluble in water due to its hydrophobic cyclohexyl group. The compound is sensitive to moisture and air, necessitating careful handling and storage under inert conditions. Its reactivity is primarily attributed to the boron atom, which can participate in nucleophilic attacks and coordinate with various electrophiles. Overall, this compound is valuable in the field of medicinal chemistry and materials science for its role in constructing complex molecular architectures.
Formula:C12H23BO2
InChI:InChI=1/C12H23BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h10H,5-9H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(C2CCCCC2)O1
Synonyms:- 2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C12H23BO2Purity:>97.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:210.12Cyclohexylboronic acid pinacol ester, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H23BO2Purity:97%Molecular weight:210.12Cyclohexylboronic acid, pinacol ester
CAS:Formula:C12H23BO2Purity:95%Color and Shape:LiquidMolecular weight:210.1208Cyclohexylboronic acid, pinacol ester
CAS:Cyclohexylboronic acid, pinacol esterFormula:C12H23BO2Purity:97%Color and Shape: colourless liquidMolecular weight:210.12g/mol2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C12H23BO2Purity:95%Color and Shape:LiquidMolecular weight:210.12





