CAS 87100-28-5
:Benzylboronic acid pinacol ester
Description:
Benzylboronic acid pinacol ester, with the CAS number 87100-28-5, is an organoboron compound characterized by the presence of a boronic acid functional group esterified with pinacol and a benzyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its utility in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, where it serves as a versatile building block for the formation of carbon-carbon bonds. The presence of the boron atom allows for the formation of stable complexes with various nucleophiles, enhancing its reactivity. Additionally, the pinacol ester moiety provides stability and solubility in organic solvents, making it easier to handle in laboratory settings. Benzylboronic acid pinacol ester is also of interest in medicinal chemistry and materials science due to its potential applications in drug development and the synthesis of functionalized polymers. Proper handling and storage are essential, as with many organoboron compounds, to maintain its reactivity and prevent degradation.
Formula:C13H19BO2
InChI:InChI=1/C13H19BO2/c1-12(2)13(3,4)16-14(15-12)10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(Cc2ccccc2)O1
Synonyms:- 1,3,2-Dioxaborolane, 4,4,5,5-Tetramethyl-2-(Phenylmethyl)-
- 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C13H19BO2Purity:>97.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:218.10Benzylboronic acid pinacol ester, 96%
CAS:Benzylboronic acid pinacol ester finds application in Pd (0)-mediated [11 C] carbonylation reaction. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AesarFormula:C13H19BO2Purity:96%Color and Shape:Clear to faintly turbid colorless to pale yellow, LiquidMolecular weight:218.10Benzylboronic acid pinacol ester
CAS:Formula:C13H19BO2Purity:97%Color and Shape:ClearMolecular weight:218.12-benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C13H19BO2Purity:97%Color and Shape:SolidMolecular weight:218.0998Benzylboronic acid pinacol ester
CAS:Benzylboronic acid pinacol esterFormula:C13H19BO2Purity:97%Color and Shape: colourless liquidMolecular weight:218.10g/mol




