
CAS 871018-11-0
:L-Cysteine, methyl ester, dihydrochloride
Description:
L-Cysteine, methyl ester, dihydrochloride is a derivative of the amino acid L-cysteine, characterized by the presence of a methyl ester group and two hydrochloride ions. This compound is typically a white to off-white crystalline powder, soluble in water due to its ionic nature. It is known for its role in biochemical processes, particularly in protein synthesis and as a precursor to the antioxidant glutathione. The methyl ester modification enhances its stability and bioavailability compared to free L-cysteine. In terms of its chemical properties, it exhibits both acidic and basic characteristics, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitutions. L-Cysteine, methyl ester, dihydrochloride is often used in research and pharmaceutical applications, particularly in studies related to cellular metabolism and oxidative stress. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C4H9NO2S·2ClH
InChI:InChI=1S/C4H9NO2S.2ClH/c1-7-4(6)3(5)2-8;;/h3,8H,2,5H2,1H3;2*1H/t3-;;/m0../s1
InChI key:InChIKey=GEKPLUAVYGHTPM-QTNFYWBSSA-N
SMILES:[C@@H](C(OC)=O)(CS)N.Cl
Synonyms:- L-Cysteine, methyl ester, dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
