
CAS 871024-48-5
:4-Chloro-5-[(tetrahydro-2-furanyl)methyl]-5H-pyrrolo[3,2-d]pyrimidine
Description:
4-Chloro-5-[(tetrahydro-2-furanyl)methyl]-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrimidine ring fused with a pyrrole moiety. The presence of a chloro substituent at the 4-position and a tetrahydro-2-furanyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar and non-polar functional groups. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's reactivity can be influenced by the presence of the chloro group, which may participate in nucleophilic substitution reactions. Additionally, the tetrahydrofuran moiety can provide stability and influence the compound's interaction with biological targets. Overall, 4-Chloro-5-[(tetrahydro-2-furanyl)methyl]-5H-pyrrolo[3,2-d]pyrimidine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals.
Formula:C11H12ClN3O
InChI:InChI=1S/C11H12ClN3O/c12-11-10-9(13-7-14-11)3-4-15(10)6-8-2-1-5-16-8/h3-4,7-8H,1-2,5-6H2
InChI key:InChIKey=UHVCVDALCUSVLK-UHFFFAOYSA-N
SMILES:C(N1C=2C(C=C1)=NC=NC2Cl)C3CCCO3
Synonyms:- 4-Chloro-5-[(tetrahydro-2-furanyl)methyl]-5H-pyrrolo[3,2-d]pyrimidine
- 5H-Pyrrolo[3,2-d]pyrimidine, 4-chloro-5-[(tetrahydro-2-furanyl)methyl]-
- 4-Chloro-5-((tetrahydro-furan-2-yl)methyl)-5H-pyrrolo[3,2-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-5-((tetrahydrofuran-2-yl)methyl)-5H-pyrrolo[3,2-d]pyrimidine
CAS:Formula:C11H12ClN3OMolecular weight:237.6855
