
CAS 87106-17-0
:1H-Pyrrole, 3,4-dimethyl-, homopolymer
Description:
1H-Pyrrole, 3,4-dimethyl-, homopolymer, identified by CAS number 87106-17-0, is a synthetic polymer derived from the polymerization of 3,4-dimethylpyrrole monomers. This substance exhibits characteristics typical of pyrrole-based polymers, including good thermal stability and electrical conductivity, which can be attributed to the conjugated π-electron system present in the pyrrole rings. The polymer is generally soluble in organic solvents, making it suitable for various applications in coatings, adhesives, and electronic materials. Its structure allows for potential modifications, enhancing properties such as mechanical strength and flexibility. Additionally, the presence of methyl groups in the 3 and 4 positions of the pyrrole ring can influence the polymer's reactivity and interaction with other materials. Overall, 1H-Pyrrole, 3,4-dimethyl-, homopolymer is a versatile compound with promising applications in advanced materials science and organic electronics.
Formula:(C6H9N)x
InChI:InChI=1S/C6H9N/c1-5-3-7-4-6(5)2/h3-4,7H,1-2H3
InChI key:InChIKey=OJFOWGWQOFZNNJ-UHFFFAOYSA-N
SMILES:CC=1C(C)=CNC1
Synonyms:- 1H-Pyrrole, 3,4-dimethyl-, homopolymer
- Poly(3,4-dimethylpyrrole)
- Poly(β,β′-dimethylpyrrole)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
